C11H22O4S — CID 103408956
2-[3-(2-methoxyethoxy)propylsulfanyl]-3-methylbutanoic acid (PubChem CID 103408956) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propylsulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[3-(2-methoxyethoxy)propylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 103408956 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propylsulfanyl]-3-methylbutanoic acid |
| SMILES | COCCOCCCSC(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H22O4S/c1-9(2)10(11(12)13)16-8-4-5-15-7-6-14-3/h9-10H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | SNAVDZXRMRWIRE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|