C8H14O4S — CID 43617838
2-(2-methoxy-2-oxoethyl)sulfanyl-3-methylbutanoic acid (PubChem CID 43617838) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-(2-methoxy-2-oxoethyl)sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-(2-methoxy-2-oxoethyl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43617838 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-(2-methoxy-2-oxoethyl)sulfanyl-3-methylbutanoic acid |
| SMILES | COC(=O)CSC(C(=O)O)C(C)C |
| InChI | InChI=1S/C8H14O4S/c1-5(2)7(8(10)11)13-4-6(9)12-3/h5,7H,4H2,1-3H3,(H,10,11) |
| InChIKey | BFNCTNHFYLYBQW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |