C8H16O3S — CID 105354037
2-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid (PubChem CID 105354037) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid.
| Compound Name | 2-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354037 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-(2-hydroxypropylsulfanyl)-3-methylbutanoic acid |
| SMILES | CC(O)CSC(C(=O)O)C(C)C |
| InChI | InChI=1S/C8H16O3S/c1-5(2)7(8(10)11)12-4-6(3)9/h5-7,9H,4H2,1-3H3,(H,10,11) |
| InChIKey | UWHAOWXJHDIXAE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |