C8H16O2S — CID 43188406
3-methyl-2-propylsulfanylbutanoic acid (PubChem CID 43188406) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-methyl-2-propylsulfanylbutanoic acid.
| Compound Name | 3-methyl-2-propylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43188406 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-methyl-2-propylsulfanylbutanoic acid |
| SMILES | CCCSC(C(=O)O)C(C)C |
| InChI | InChI=1S/C8H16O2S/c1-4-5-11-7(6(2)3)8(9)10/h6-7H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | SCCSZSXGXQXVBP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |