C10H16N2O3S — CID 105353419
2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 105353419) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105353419 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)C(SCC(=O)NCCC#N)C(=O)O |
| InChI | InChI=1S/C10H16N2O3S/c1-7(2)9(10(14)15)16-6-8(13)12-5-3-4-11/h7,9H,3,5-6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | QULGGCDNCJFXQO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|