C9H16N2O2S — CID 66105822
N-(2-cyanoethyl)-2-(3-hydroxy-2-methylpropyl)sulfanylacetamide (PubChem CID 66105822) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-hydroxy-2-methylpropyl)sulfanylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-hydroxy-2-methylpropyl)sulfanylacetamide |
|---|---|
| PubChem CID | 66105822 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-hydroxy-2-methylpropyl)sulfanylacetamide |
| SMILES | CC(CO)CSCC(=O)NCCC#N |
| InChI | InChI=1S/C9H16N2O2S/c1-8(5-12)6-14-7-9(13)11-4-2-3-10/h8,12H,2,4-7H2,1H3,(H,11,13) |
| InChIKey | XYGQEJBBBFYPFS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|