C16H24O3S — CID 105353840
2-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid (PubChem CID 105353840) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105353840 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)cc(OCCCSC(C(=O)O)C(C)C)c1 |
| InChI | InChI=1S/C16H24O3S/c1-11(2)15(16(17)18)20-7-5-6-19-14-9-12(3)8-13(4)10-14/h8-11,15H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | SCDBCGRBEUBPMC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|