C16H25NO3S — CID 106442429
(2R)-2-amino-3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid (PubChem CID 106442429) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442429 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-2-amino-3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)cc(OCCCSC(C)(C)[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C16H25NO3S/c1-11-8-12(2)10-13(9-11)20-6-5-7-21-16(3,4)14(17)15(18)19/h8-10,14H,5-7,17H2,1-4H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | LHIFDBQDHGLSOU-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|