C19H26Br2O6 — CID 138751500
2-[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxy]-5-methylphenoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 138751500) has the molecular formula C19H26Br2O6 and a molecular weight of 510.22 g/mol. Its IUPAC name is 2-[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxy]-5-methylphenoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxy]-5-methylphenoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 138751500 |
| Molecular Formula | C19H26Br2O6 |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 2-[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxy]-5-methylphenoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | Cc1cc(OCCOC(=O)C(C)(C)Br)cc(OCCOC(=O)C(C)(C)Br)c1 |
| InChI | InChI=1S/C19H26Br2O6/c1-13-10-14(24-6-8-26-16(22)18(2,3)20)12-15(11-13)25-7-9-27-17(23)19(4,5)21/h10-12H,6-9H2,1-5H3 |
| InChIKey | SHXJLYRCTBCIMK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|