2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid

C16H25NO3 — CID 43468764

IUPAC2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid
SMILESCc1cc(C)cc(OCCCNC(C(=O)O)C(C)C)c1
InChIInChI=1S/C16H25NO3/c1-11(2)15(16(18)19)17-6-5-7-20-14-9-12(3)8-13(4)10-14/h8-11,15,17H,5-7H2,1-4H3,(H,18,19)
InChIKeyRRMRNMVWHYWTER-UHFFFAOYSA-N
MW279.38 g/mol
LogP2.77
Rot. Bonds8

About 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid

2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid (PubChem CID 43468764) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid
PubChem CID43468764
Molecular FormulaC16H25NO3
Molecular Weight279.38 g/mol
Exact Mass279.18
IUPAC Name2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid
SMILESCc1cc(C)cc(OCCCNC(C(=O)O)C(C)C)c1
InChIInChI=1S/C16H25NO3/c1-11(2)15(16(18)19)17-6-5-7-20-14-9-12(3)8-13(4)10-14/h8-11,15,17H,5-7H2,1-4H3,(H,18,19)
InChIKeyRRMRNMVWHYWTER-UHFFFAOYSA-N
XLogP2.77
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.38
LogP ≤ 52.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid?
The IUPAC name of 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid (CID 43468764) is 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid.
What is the SMILES notation for 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid?
The canonical SMILES for 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid is Cc1cc(C)cc(OCCCNC(C(=O)O)C(C)C)c1.
What is the InChIKey of 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid?
The InChIKey is RRMRNMVWHYWTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-11(2)15(16(18)19)17-6-5-7-20-14-9-12(3)8-13(4)10-14/h8-11,15,17H,5-7H2,1-4H3,(H,18,19).
What are the key properties of 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid?
2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid has a molecular weight of 279.38 g/mol, XLogP of 2.77, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-dimethylphenoxy)propylamino]-3-methylbutanoic acid is sourced from PubChem (CID 43468764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).