C28H33NO2 — CID 67846665
1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(propylamino)propan-2-ol (PubChem CID 67846665) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(propylamino)propan-2-ol.
| Compound Name | 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 67846665 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)COc1ccc(C(=C(CC)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33NO2/c1-3-19-29-20-25(30)21-31-26-17-15-24(16-18-26)28(23-13-9-6-10-14-23)27(4-2)22-11-7-5-8-12-22/h5-18,25,29-30H,3-4,19-21H2,1-2H3 |
| InChIKey | LAISNPFVQJWXGK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|