C26H29NO2 — CID 67847195
1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 67847195) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 67847195 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[4-(1,2-diphenylbut-1-enyl)phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCC(O)CNC)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-3-25(20-10-6-4-7-11-20)26(21-12-8-5-9-13-21)22-14-16-24(17-15-22)29-19-23(28)18-27-2/h4-17,23,27-28H,3,18-19H2,1-2H3 |
| InChIKey | XAACHYMRCCBAMV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|