C29H33NO6 — CID 67846564
1-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 67846564) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is 1-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 67846564 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 1-[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(methoxymethoxy)phenyl]but-1-enyl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | CCC(=C(c1ccc(OCOC)cc1)c1ccc(OCC(O)CNC)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H33NO6/c1-4-26(22-9-14-27-28(15-22)36-19-35-27)29(21-7-12-25(13-8-21)34-18-32-3)20-5-10-24(11-6-20)33-17-23(31)16-30-2/h5-15,23,30-31H,4,16-19H2,1-3H3 |
| InChIKey | LSSFMQITXQOMBG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|