C18H20O15 — CID 91449850
4-[(2S,3S,4R,5R)-2,3-bis(3-carboxyprop-2-enoyloxy)-4,5,6-trihydroxyhexoxy]-4-oxobut-2-enoic acid (PubChem CID 91449850) has the molecular formula C18H20O15 and a molecular weight of 476.34 g/mol. Its IUPAC name is 4-[(2S,3S,4R,5R)-2,3-bis(3-carboxyprop-2-enoyloxy)-4,5,6-trihydroxyhexoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2S,3S,4R,5R)-2,3-bis(3-carboxyprop-2-enoyloxy)-4,5,6-trihydroxyhexoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 91449850 |
| Molecular Formula | C18H20O15 |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 4-[(2S,3S,4R,5R)-2,3-bis(3-carboxyprop-2-enoyloxy)-4,5,6-trihydroxyhexoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)OC[C@H](OC(=O)C=CC(=O)O)[C@@H](OC(=O)C=CC(=O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H20O15/c19-7-9(20)17(30)18(33-16(29)6-3-13(25)26)10(32-15(28)5-2-12(23)24)8-31-14(27)4-1-11(21)22/h1-6,9-10,17-20,30H,7-8H2,(H,21,22)(H,23,24)(H,25,26)/t9-,10+,17-,18-/m1/s1 |
| InChIKey | ZDFYJIPVEKNDHA-AYBUMKCRSA-N |
| XLogP | -3.01 |
| TPSA | 251.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|