C9H14O12 — CID 54363619
[(2S,3S,4R,5R)-1,2-dicarboxyoxy-4,5,6-trihydroxyhexan-3-yl] hydrogen carbonate (PubChem CID 54363619) has the molecular formula C9H14O12 and a molecular weight of 314.20 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-1,2-dicarboxyoxy-4,5,6-trihydroxyhexan-3-yl] hydrogen carbonate.
| Compound Name | [(2S,3S,4R,5R)-1,2-dicarboxyoxy-4,5,6-trihydroxyhexan-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 54363619 |
| Molecular Formula | C9H14O12 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [(2S,3S,4R,5R)-1,2-dicarboxyoxy-4,5,6-trihydroxyhexan-3-yl] hydrogen carbonate |
| SMILES | O=C(O)OC[C@H](OC(=O)O)[C@@H](OC(=O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H14O12/c10-1-3(11)5(12)6(21-9(17)18)4(20-8(15)16)2-19-7(13)14/h3-6,10-12H,1-2H2,(H,13,14)(H,15,16)(H,17,18)/t3-,4+,5-,6-/m1/s1 |
| InChIKey | UOFPIGVQTDDAPR-JGWLITMVSA-N |
| XLogP | -1.48 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|