C10H16O11 — CID 155146644
(Z)-but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 155146644) has the molecular formula C10H16O11 and a molecular weight of 312.23 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (Z)-but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 155146644 |
| Molecular Formula | C10H16O11 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7.C4H4O4/c7-1-2(8)3(9)4(10)5(11)6(12)13;5-3(6)1-2-4(7)8/h2-5,7-11H,1H2,(H,12,13);1-2H,(H,5,6)(H,7,8)/b;2-1-/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | YPYTXXPSBPWTLV-DZHLBYGTSA-N |
| XLogP | -3.78 |
| TPSA | 213.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|