C8H17BrO — CID 21319862
6-bromo-2,5-dimethylhexan-1-ol (PubChem CID 21319862) has the molecular formula C8H17BrO and a molecular weight of 209.13 g/mol. Its IUPAC name is 6-bromo-2,5-dimethylhexan-1-ol.
| Compound Name | 6-bromo-2,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 21319862 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-bromo-2,5-dimethylhexan-1-ol |
| SMILES | CC(CO)CCC(C)CBr |
| InChI | InChI=1S/C8H17BrO/c1-7(5-9)3-4-8(2)6-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | LHFUDSBJAVQZHJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|