About 6-bromo-2,5-dimethylhexan-1-ol
6-bromo-2,5-dimethylhexan-1-ol (PubChem CID 21319862) has the molecular formula C8H17BrO
and a molecular weight of 209.13 g/mol. Its IUPAC name is 6-bromo-2,5-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 6-bromo-2,5-dimethylhexan-1-ol |
| PubChem CID | 21319862 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-bromo-2,5-dimethylhexan-1-ol |
| SMILES | CC(CO)CCC(C)CBr |
| InChI | InChI=1S/C8H17BrO/c1-7(5-9)3-4-8(2)6-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | LHFUDSBJAVQZHJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,5-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,5-dimethylhexan-1-ol?
The IUPAC name of 6-bromo-2,5-dimethylhexan-1-ol (CID 21319862) is 6-bromo-2,5-dimethylhexan-1-ol.
What is the SMILES notation for 6-bromo-2,5-dimethylhexan-1-ol?
The canonical SMILES for 6-bromo-2,5-dimethylhexan-1-ol is CC(CO)CCC(C)CBr.
What is the InChIKey of 6-bromo-2,5-dimethylhexan-1-ol?
The InChIKey is LHFUDSBJAVQZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO/c1-7(5-9)3-4-8(2)6-10/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 6-bromo-2,5-dimethylhexan-1-ol?
6-bromo-2,5-dimethylhexan-1-ol has a molecular weight of 209.13 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,5-dimethylhexan-1-ol is sourced from PubChem (CID 21319862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).