C10H20Br2 — CID 170903621
1,8-dibromo-2,7-dimethyloctane (PubChem CID 170903621) has the molecular formula C10H20Br2 and a molecular weight of 300.08 g/mol. Its IUPAC name is 1,8-dibromo-2,7-dimethyloctane.
| Compound Name | 1,8-dibromo-2,7-dimethyloctane |
|---|---|
| PubChem CID | 170903621 |
| Molecular Formula | C10H20Br2 |
| Molecular Weight | 300.08 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1,8-dibromo-2,7-dimethyloctane |
| SMILES | CC(CBr)CCCCC(C)CBr |
| InChI | InChI=1S/C10H20Br2/c1-9(7-11)5-3-4-6-10(2)8-12/h9-10H,3-8H2,1-2H3 |
| InChIKey | FZLPRAIBQQWIMJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.08 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|