About carbanide;2-methylbutane-1,4-diol;titanium(2+)
carbanide;2-methylbutane-1,4-diol;titanium(2+) (PubChem CID 134981469) has the molecular formula C7H18O2Ti
and a molecular weight of 182.09 g/mol. Its IUPAC name is carbanide;2-methylbutane-1,4-diol;titanium(2+).
Molecular Properties
| Compound Name | carbanide;2-methylbutane-1,4-diol;titanium(2+) |
| PubChem CID | 134981469 |
| Molecular Formula | C7H18O2Ti |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | carbanide;2-methylbutane-1,4-diol;titanium(2+) |
| SMILES | CC(CO)CCO.[CH3-].[CH3-].[Ti+2] |
| InChI | InChI=1S/C5H12O2.2CH3.Ti/c1-5(4-7)2-3-6;;;/h5-7H,2-4H2,1H3;2*1H3;/q;2*-1;+2 |
| InChIKey | CMGSLWSAANGYCU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-methylbutane-1,4-diol;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-methylbutane-1,4-diol;titanium(2+)?
The IUPAC name of carbanide;2-methylbutane-1,4-diol;titanium(2+) (CID 134981469) is carbanide;2-methylbutane-1,4-diol;titanium(2+).
What is the SMILES notation for carbanide;2-methylbutane-1,4-diol;titanium(2+)?
The canonical SMILES for carbanide;2-methylbutane-1,4-diol;titanium(2+) is CC(CO)CCO.[CH3-].[CH3-].[Ti+2].
What is the InChIKey of carbanide;2-methylbutane-1,4-diol;titanium(2+)?
The InChIKey is CMGSLWSAANGYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.2CH3.Ti/c1-5(4-7)2-3-6;;;/h5-7H,2-4H2,1H3;2*1H3;/q;2*-1;+2.
What are the key properties of carbanide;2-methylbutane-1,4-diol;titanium(2+)?
carbanide;2-methylbutane-1,4-diol;titanium(2+) has a molecular weight of 182.09 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-methylbutane-1,4-diol;titanium(2+) is sourced from PubChem (CID 134981469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).