C9H22O4 — CID 158938905
butane-1,4-diol;2-methylbutane-1,4-diol (PubChem CID 158938905) has the molecular formula C9H22O4 and a molecular weight of 194.27 g/mol. Its IUPAC name is butane-1,4-diol;2-methylbutane-1,4-diol.
| Compound Name | butane-1,4-diol;2-methylbutane-1,4-diol |
|---|---|
| PubChem CID | 158938905 |
| Molecular Formula | C9H22O4 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | butane-1,4-diol;2-methylbutane-1,4-diol |
| SMILES | CC(CO)CCO.OCCCCO |
| InChI | InChI=1S/C5H12O2.C4H10O2/c1-5(4-7)2-3-6;5-3-1-2-4-6/h5-7H,2-4H2,1H3;5-6H,1-4H2 |
| InChIKey | JJZSXJMEVKEGPW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|