C13H23F2NO4 — CID 107473822
2-[[3-(2,2-difluoroethoxy)propanoylamino]methyl]-4,4-dimethylpentanoic acid (PubChem CID 107473822) has the molecular formula C13H23F2NO4 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)propanoylamino]methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)propanoylamino]methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107473822 |
| Molecular Formula | C13H23F2NO4 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)propanoylamino]methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(CNC(=O)CCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C13H23F2NO4/c1-13(2,3)6-9(12(18)19)7-16-11(17)4-5-20-8-10(14)15/h9-10H,4-8H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | HCYFEOSARNDJNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|