C16H20BrN2O2S+ — CID 9299518
(5-bromothiophen-2-yl)methyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methylazanium (PubChem CID 9299518) has the molecular formula C16H20BrN2O2S+ and a molecular weight of 384.32 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9299518 |
| Molecular Formula | C16H20BrN2O2S+ |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(CNC(=O)C[NH+](C)Cc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C16H19BrN2O2S/c1-19(10-14-7-8-15(17)22-14)11-16(20)18-9-12-3-5-13(21-2)6-4-12/h3-8H,9-11H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | JXCZYNINMQEYLP-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |