C19H33IN4O3 — CID 111214702
N-[2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111214702) has the molecular formula C19H33IN4O3 and a molecular weight of 492.40 g/mol. Its IUPAC name is N-[2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111214702 |
| Molecular Formula | C19H33IN4O3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[2-[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H32N4O3.HI/c1-19(2,3)17(24)21-11-12-23-18(20-4)22-10-9-14-7-8-15(25-5)16(13-14)26-6;/h7-8,13H,9-12H2,1-6H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | SYYSZYOLFSFATC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|