C20H33NO5Si — CID 171419580
[[2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]acetyl]amino] 2,2-dimethylpropanoate (PubChem CID 171419580) has the molecular formula C20H33NO5Si and a molecular weight of 395.57 g/mol. Its IUPAC name is [[2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]acetyl]amino] 2,2-dimethylpropanoate.
| Compound Name | [[2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]acetyl]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171419580 |
| Molecular Formula | C20H33NO5Si |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [[2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]acetyl]amino] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CC(=O)NOC(=O)C(C)(C)C)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO5Si/c1-19(2,3)18(23)25-21-17(22)13-14-10-11-15(16(12-14)24-7)26-27(8,9)20(4,5)6/h10-12H,13H2,1-9H3,(H,21,22) |
| InChIKey | WLMRUZCAXGHZRO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|