C24H45NO4Si2 — CID 91749297
2-methylpropyl N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]carbamate (PubChem CID 91749297) has the molecular formula C24H45NO4Si2 and a molecular weight of 467.80 g/mol. Its IUPAC name is 2-methylpropyl N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]carbamate.
| Compound Name | 2-methylpropyl N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 91749297 |
| Molecular Formula | C24H45NO4Si2 |
| Molecular Weight | 467.80 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2-methylpropyl N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]carbamate |
| SMILES | CC(C)COC(=O)NCc1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C24H45NO4Si2/c1-18(2)17-27-22(26)25-16-19-13-14-20(28-30(9,10)23(3,4)5)21(15-19)29-31(11,12)24(6,7)8/h13-15,18H,16-17H2,1-12H3,(H,25,26) |
| InChIKey | ADJJDUGHPCMVNR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.80 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|