C20H26O7 — CID 10714660
(1R,2R)-3-[2,4-dimethoxy-6-(methoxymethoxy)phenyl]-1-(3-methoxyphenyl)propane-1,2-diol (PubChem CID 10714660) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is (1R,2R)-3-[2,4-dimethoxy-6-(methoxymethoxy)phenyl]-1-(3-methoxyphenyl)propane-1,2-diol.
| Compound Name | (1R,2R)-3-[2,4-dimethoxy-6-(methoxymethoxy)phenyl]-1-(3-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 10714660 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (1R,2R)-3-[2,4-dimethoxy-6-(methoxymethoxy)phenyl]-1-(3-methoxyphenyl)propane-1,2-diol |
| SMILES | COCOc1cc(OC)cc(OC)c1C[C@@H](O)[C@H](O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H26O7/c1-23-12-27-19-10-15(25-3)9-18(26-4)16(19)11-17(21)20(22)13-6-5-7-14(8-13)24-2/h5-10,17,20-22H,11-12H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | DLKVYKRBXSMEDJ-YLJYHZDGSA-N |
| XLogP | 2.33 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|