C12H18O4 — CID 175226142
3-ethoxy-1-(3-methoxyphenyl)propane-1,2-diol (PubChem CID 175226142) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-ethoxy-1-(3-methoxyphenyl)propane-1,2-diol.
| Compound Name | 3-ethoxy-1-(3-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 175226142 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-ethoxy-1-(3-methoxyphenyl)propane-1,2-diol |
| SMILES | CCOCC(O)C(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C12H18O4/c1-3-16-8-11(13)12(14)9-5-4-6-10(7-9)15-2/h4-7,11-14H,3,8H2,1-2H3 |
| InChIKey | LCSWEJIWPWFMCG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |