C13H20O2 — CID 114976753
1-(3-methoxyphenyl)-2,3-dimethylbutan-1-ol (PubChem CID 114976753) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | 1-(3-methoxyphenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 114976753 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,3-dimethylbutan-1-ol |
| SMILES | COc1cccc(C(O)C(C)C(C)C)c1 |
| InChI | InChI=1S/C13H20O2/c1-9(2)10(3)13(14)11-6-5-7-12(8-11)15-4/h5-10,13-14H,1-4H3 |
| InChIKey | MQGQLARUIIHCKP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |