C21H28O8 — CID 10993232
(1S,2S)-3-[2,4-bis(methoxymethoxy)phenyl]-1-[4-(methoxymethoxy)phenyl]propane-1,2-diol (PubChem CID 10993232) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is (1S,2S)-3-[2,4-bis(methoxymethoxy)phenyl]-1-[4-(methoxymethoxy)phenyl]propane-1,2-diol.
| Compound Name | (1S,2S)-3-[2,4-bis(methoxymethoxy)phenyl]-1-[4-(methoxymethoxy)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 10993232 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (1S,2S)-3-[2,4-bis(methoxymethoxy)phenyl]-1-[4-(methoxymethoxy)phenyl]propane-1,2-diol |
| SMILES | COCOc1ccc([C@H](O)[C@@H](O)Cc2ccc(OCOC)cc2OCOC)cc1 |
| InChI | InChI=1S/C21H28O8/c1-24-12-27-17-7-4-15(5-8-17)21(23)19(22)10-16-6-9-18(28-13-25-2)11-20(16)29-14-26-3/h4-9,11,19,21-23H,10,12-14H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | NCVPBRYQZVLCKK-FPOVZHCZSA-N |
| XLogP | 2.27 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|