C16H18Br2O6 — CID 157301717
4-bromobenzene-1,3-diol;1-bromo-2,4-bis(methoxymethoxy)benzene (PubChem CID 157301717) has the molecular formula C16H18Br2O6 and a molecular weight of 466.12 g/mol. Its IUPAC name is 4-bromobenzene-1,3-diol;1-bromo-2,4-bis(methoxymethoxy)benzene.
| Compound Name | 4-bromobenzene-1,3-diol;1-bromo-2,4-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 157301717 |
| Molecular Formula | C16H18Br2O6 |
| Molecular Weight | 466.12 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | 4-bromobenzene-1,3-diol;1-bromo-2,4-bis(methoxymethoxy)benzene |
| SMILES | COCOc1ccc(Br)c(OCOC)c1.Oc1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C10H13BrO4.C6H5BrO2/c1-12-6-14-8-3-4-9(11)10(5-8)15-7-13-2;7-5-2-1-4(8)3-6(5)9/h3-5H,6-7H2,1-2H3;1-3,8-9H |
| InChIKey | BBZBUBFCFPFCIA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|