C26H29NO8 — CID 159072852
3-[2,4-bis(methoxymethoxy)phenyl]cyclopent-2-en-1-one;4-(3-hydroxyiminocyclopenten-1-yl)benzene-1,3-diol (PubChem CID 159072852) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is 3-[2,4-bis(methoxymethoxy)phenyl]cyclopent-2-en-1-one;4-(3-hydroxyiminocyclopenten-1-yl)benzene-1,3-diol.
| Compound Name | 3-[2,4-bis(methoxymethoxy)phenyl]cyclopent-2-en-1-one;4-(3-hydroxyiminocyclopenten-1-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 159072852 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[2,4-bis(methoxymethoxy)phenyl]cyclopent-2-en-1-one;4-(3-hydroxyiminocyclopenten-1-yl)benzene-1,3-diol |
| SMILES | COCOc1ccc(C2=CC(=O)CC2)c(OCOC)c1.ON=C1C=C(c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C15H18O5.C11H11NO3/c1-17-9-19-13-5-6-14(11-3-4-12(16)7-11)15(8-13)20-10-18-2;13-9-3-4-10(11(14)6-9)7-1-2-8(5-7)12-15/h5-8H,3-4,9-10H2,1-2H3;3-6,13-15H,1-2H2 |
| InChIKey | JZWQYEMUOBCLMO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|