C14H16O6 — CID 134859376
methyl 3-[2,4-bis(methoxymethoxy)phenyl]prop-2-ynoate (PubChem CID 134859376) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 3-[2,4-bis(methoxymethoxy)phenyl]prop-2-ynoate.
| Compound Name | methyl 3-[2,4-bis(methoxymethoxy)phenyl]prop-2-ynoate |
|---|---|
| PubChem CID | 134859376 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl 3-[2,4-bis(methoxymethoxy)phenyl]prop-2-ynoate |
| SMILES | COCOc1ccc(C#CC(=O)OC)c(OCOC)c1 |
| InChI | InChI=1S/C14H16O6/c1-16-9-19-12-6-4-11(5-7-14(15)18-3)13(8-12)20-10-17-2/h4,6,8H,9-10H2,1-3H3 |
| InChIKey | CMNAHWOVJJPDFD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|