C17H16CrO10 — CID 14327199
[[2,5-bis(methoxymethoxy)phenyl]-methoxymethylidene]chromium;carbon monoxide (PubChem CID 14327199) has the molecular formula C17H16CrO10 and a molecular weight of 432.30 g/mol. Its IUPAC name is [[2,5-bis(methoxymethoxy)phenyl]-methoxymethylidene]chromium;carbon monoxide.
| Compound Name | [[2,5-bis(methoxymethoxy)phenyl]-methoxymethylidene]chromium;carbon monoxide |
|---|---|
| PubChem CID | 14327199 |
| Molecular Formula | C17H16CrO10 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | [[2,5-bis(methoxymethoxy)phenyl]-methoxymethylidene]chromium;carbon monoxide |
| SMILES | COCOc1ccc(OCOC)c(C(=[Cr])OC)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C12H16O5.5CO.Cr/c1-13-7-10-6-11(16-8-14-2)4-5-12(10)17-9-15-3;5*1-2;/h4-6H,8-9H2,1-3H3;;;;;; |
| InChIKey | JOVQDHRZBBHAON-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 145.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|