C20H22O6 — CID 146188956
methyl (E)-3-[2,5-bis(methoxymethoxy)phenyl]-3-phenylprop-2-enoate (PubChem CID 146188956) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (E)-3-[2,5-bis(methoxymethoxy)phenyl]-3-phenylprop-2-enoate.
| Compound Name | methyl (E)-3-[2,5-bis(methoxymethoxy)phenyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 146188956 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (E)-3-[2,5-bis(methoxymethoxy)phenyl]-3-phenylprop-2-enoate |
| SMILES | COCOc1ccc(OCOC)c(/C(=C/C(=O)OC)c2ccccc2)c1 |
| InChI | InChI=1S/C20H22O6/c1-22-13-25-16-9-10-19(26-14-23-2)18(11-16)17(12-20(21)24-3)15-7-5-4-6-8-15/h4-12H,13-14H2,1-3H3/b17-12+ |
| InChIKey | SYROWVIIZIAXIS-SFQUDFHCSA-N |
| XLogP | 3.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|