C16H21NO5 — CID 141026954
N-[2-[2,4-bis(methoxymethoxy)phenyl]cyclohex-2-en-1-ylidene]hydroxylamine (PubChem CID 141026954) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[2-[2,4-bis(methoxymethoxy)phenyl]cyclohex-2-en-1-ylidene]hydroxylamine.
| Compound Name | N-[2-[2,4-bis(methoxymethoxy)phenyl]cyclohex-2-en-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 141026954 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[2-[2,4-bis(methoxymethoxy)phenyl]cyclohex-2-en-1-ylidene]hydroxylamine |
| SMILES | COCOc1ccc(C2=CCCCC2=NO)c(OCOC)c1 |
| InChI | InChI=1S/C16H21NO5/c1-19-10-21-12-7-8-14(16(9-12)22-11-20-2)13-5-3-4-6-15(13)17-18/h5,7-9,18H,3-4,6,10-11H2,1-2H3 |
| InChIKey | DJEQLALBVQOBPX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|