C15H18O6S4 — CID 87133267
4-[2,4-bis(methoxymethoxy)phenyl]-2,3,5,6-tetrakis(sulfanyl)pyran-4-ol (PubChem CID 87133267) has the molecular formula C15H18O6S4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[2,4-bis(methoxymethoxy)phenyl]-2,3,5,6-tetrakis(sulfanyl)pyran-4-ol.
| Compound Name | 4-[2,4-bis(methoxymethoxy)phenyl]-2,3,5,6-tetrakis(sulfanyl)pyran-4-ol |
|---|---|
| PubChem CID | 87133267 |
| Molecular Formula | C15H18O6S4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 4-[2,4-bis(methoxymethoxy)phenyl]-2,3,5,6-tetrakis(sulfanyl)pyran-4-ol |
| SMILES | COCOc1ccc(C2(O)C(S)=C(S)OC(S)=C2S)c(OCOC)c1 |
| InChI | InChI=1S/C15H18O6S4/c1-17-6-19-8-3-4-9(10(5-8)20-7-18-2)15(16)11(22)13(24)21-14(25)12(15)23/h3-5,16,22-25H,6-7H2,1-2H3 |
| InChIKey | HGBVLJGHCJZQOS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|