C29H44O15 — CID 11433632
(2S,3S)-3-[3,4-bis(methoxymethoxy)phenyl]-2,3-bis(methoxymethoxy)-1-[2,4,6-tris(methoxymethoxy)phenyl]propan-1-ol (PubChem CID 11433632) has the molecular formula C29H44O15 and a molecular weight of 632.66 g/mol. Its IUPAC name is (2S,3S)-3-[3,4-bis(methoxymethoxy)phenyl]-2,3-bis(methoxymethoxy)-1-[2,4,6-tris(methoxymethoxy)phenyl]propan-1-ol.
| Compound Name | (2S,3S)-3-[3,4-bis(methoxymethoxy)phenyl]-2,3-bis(methoxymethoxy)-1-[2,4,6-tris(methoxymethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 11433632 |
| Molecular Formula | C29H44O15 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (2S,3S)-3-[3,4-bis(methoxymethoxy)phenyl]-2,3-bis(methoxymethoxy)-1-[2,4,6-tris(methoxymethoxy)phenyl]propan-1-ol |
| SMILES | COCOc1cc(OCOC)c(C(O)[C@H](OCOC)[C@@H](OCOC)c2ccc(OCOC)c(OCOC)c2)c(OCOC)c1 |
| InChI | InChI=1S/C29H44O15/c1-31-13-38-21-11-24(41-16-34-4)26(25(12-21)42-17-35-5)27(30)29(44-19-37-7)28(43-18-36-6)20-8-9-22(39-14-32-2)23(10-20)40-15-33-3/h8-12,27-30H,13-19H2,1-7H3/t27?,28-,29-/m0/s1 |
| InChIKey | WPTCNCCYIYQORS-KEKPXRHTSA-N |
| XLogP | 2.98 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|