C30H46O14 — CID 89022664
2-[(3S,4S)-4-[3,4-bis(methoxymethoxy)phenyl]-3,4-bis(methoxymethoxy)butan-2-yl]-1,3,5-tris(methoxymethoxy)benzene (PubChem CID 89022664) has the molecular formula C30H46O14 and a molecular weight of 630.68 g/mol. Its IUPAC name is 2-[(3S,4S)-4-[3,4-bis(methoxymethoxy)phenyl]-3,4-bis(methoxymethoxy)butan-2-yl]-1,3,5-tris(methoxymethoxy)benzene.
| Compound Name | 2-[(3S,4S)-4-[3,4-bis(methoxymethoxy)phenyl]-3,4-bis(methoxymethoxy)butan-2-yl]-1,3,5-tris(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 89022664 |
| Molecular Formula | C30H46O14 |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | 2-[(3S,4S)-4-[3,4-bis(methoxymethoxy)phenyl]-3,4-bis(methoxymethoxy)butan-2-yl]-1,3,5-tris(methoxymethoxy)benzene |
| SMILES | COCOc1cc(OCOC)c(C(C)[C@H](OCOC)[C@@H](OCOC)c2ccc(OCOC)c(OCOC)c2)c(OCOC)c1 |
| InChI | InChI=1S/C30H46O14/c1-21(28-26(41-17-34-5)12-23(38-14-31-2)13-27(28)42-18-35-6)29(43-19-36-7)30(44-20-37-8)22-9-10-24(39-15-32-3)25(11-22)40-16-33-4/h9-13,21,29-30H,14-20H2,1-8H3/t21?,29-,30-/m0/s1 |
| InChIKey | KYXVIMZVKQQBTO-YCIRJXQPSA-N |
| XLogP | 4.05 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|