C22H21FO — CID 135054788
(2S)-2-(4-fluorophenyl)-2-methyl-3,3-diphenylpropan-1-ol (PubChem CID 135054788) has the molecular formula C22H21FO and a molecular weight of 320.41 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-2-methyl-3,3-diphenylpropan-1-ol.
| Compound Name | (2S)-2-(4-fluorophenyl)-2-methyl-3,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 135054788 |
| Molecular Formula | C22H21FO |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-2-methyl-3,3-diphenylpropan-1-ol |
| SMILES | C[C@@](CO)(c1ccc(F)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21FO/c1-22(16-24,19-12-14-20(23)15-13-19)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21,24H,16H2,1H3/t22-/m1/s1 |
| InChIKey | ZTGBLIJUVCCVQX-JOCHJYFZSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |