C17H18OS — CID 166858466
(2S)-3-methyl-1,1-diphenyl-2-sulfanylbut-3-en-1-ol (PubChem CID 166858466) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is (2S)-3-methyl-1,1-diphenyl-2-sulfanylbut-3-en-1-ol.
| Compound Name | (2S)-3-methyl-1,1-diphenyl-2-sulfanylbut-3-en-1-ol |
|---|---|
| PubChem CID | 166858466 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2S)-3-methyl-1,1-diphenyl-2-sulfanylbut-3-en-1-ol |
| SMILES | C=C(C)[C@H](S)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18OS/c1-13(2)16(19)17(18,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,18-19H,1H2,2H3/t16-/m0/s1 |
| InChIKey | MJSOUIPDFOJKDI-INIZCTEOSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|