C22H20O3 — CID 14061039
(2S)-2-(1-hydroxyethenoxy)-1,1,2-triphenylethanol (PubChem CID 14061039) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2S)-2-(1-hydroxyethenoxy)-1,1,2-triphenylethanol.
| Compound Name | (2S)-2-(1-hydroxyethenoxy)-1,1,2-triphenylethanol |
|---|---|
| PubChem CID | 14061039 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2S)-2-(1-hydroxyethenoxy)-1,1,2-triphenylethanol |
| SMILES | C=C(O)O[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O3/c1-17(23)25-21(18-11-5-2-6-12-18)22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,23-24H,1H2/t21-/m0/s1 |
| InChIKey | QWZMTLHCOHBZKL-NRFANRHFSA-N |
| XLogP | 4.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|