C31H34O6 — CID 71227933
1-O-ethyl 4-O-[(1R)-2-hydroxy-1,2,2-triphenylethyl] 2-hydroxy-2-(3-methylbut-2-enyl)butanedioate (PubChem CID 71227933) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[(1R)-2-hydroxy-1,2,2-triphenylethyl] 2-hydroxy-2-(3-methylbut-2-enyl)butanedioate.
| Compound Name | 1-O-ethyl 4-O-[(1R)-2-hydroxy-1,2,2-triphenylethyl] 2-hydroxy-2-(3-methylbut-2-enyl)butanedioate |
|---|---|
| PubChem CID | 71227933 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-O-ethyl 4-O-[(1R)-2-hydroxy-1,2,2-triphenylethyl] 2-hydroxy-2-(3-methylbut-2-enyl)butanedioate |
| SMILES | CCOC(=O)C(O)(CC=C(C)C)CC(=O)O[C@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34O6/c1-4-36-29(33)30(34,21-20-23(2)3)22-27(32)37-28(24-14-8-5-9-15-24)31(35,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,28,34-35H,4,21-22H2,1-3H3/t28-,30?/m1/s1 |
| InChIKey | GWYCWALCMAGEGG-KFMIKNBQSA-N |
| XLogP | 5.25 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|