C19H24O7 — CID 25215325
1-O-[(1S)-2-methoxy-2-oxo-1-phenylethyl] 4-O-methyl (2R)-2-hydroxy-2-(3-methylbut-2-enyl)butanedioate (PubChem CID 25215325) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-O-[(1S)-2-methoxy-2-oxo-1-phenylethyl] 4-O-methyl (2R)-2-hydroxy-2-(3-methylbut-2-enyl)butanedioate.
| Compound Name | 1-O-[(1S)-2-methoxy-2-oxo-1-phenylethyl] 4-O-methyl (2R)-2-hydroxy-2-(3-methylbut-2-enyl)butanedioate |
|---|---|
| PubChem CID | 25215325 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-O-[(1S)-2-methoxy-2-oxo-1-phenylethyl] 4-O-methyl (2R)-2-hydroxy-2-(3-methylbut-2-enyl)butanedioate |
| SMILES | COC(=O)C[C@](O)(CC=C(C)C)C(=O)O[C@H](C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C19H24O7/c1-13(2)10-11-19(23,12-15(20)24-3)18(22)26-16(17(21)25-4)14-8-6-5-7-9-14/h5-10,16,23H,11-12H2,1-4H3/t16-,19+/m0/s1 |
| InChIKey | NGJMPKLODVMWKR-QFBILLFUSA-N |
| XLogP | 2.09 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|