C30H36O7 — CID 14201848
[(1R)-2-hydroxy-1,2,2-triphenylethyl] (3S,5R)-3-hydroxy-5-(2-methoxyethoxymethoxy)hexanoate (PubChem CID 14201848) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(1R)-2-hydroxy-1,2,2-triphenylethyl] (3S,5R)-3-hydroxy-5-(2-methoxyethoxymethoxy)hexanoate.
| Compound Name | [(1R)-2-hydroxy-1,2,2-triphenylethyl] (3S,5R)-3-hydroxy-5-(2-methoxyethoxymethoxy)hexanoate |
|---|---|
| PubChem CID | 14201848 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [(1R)-2-hydroxy-1,2,2-triphenylethyl] (3S,5R)-3-hydroxy-5-(2-methoxyethoxymethoxy)hexanoate |
| SMILES | COCCOCO[C@H](C)C[C@H](O)CC(=O)O[C@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O7/c1-23(36-22-35-19-18-34-2)20-27(31)21-28(32)37-29(24-12-6-3-7-13-24)30(33,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-17,23,27,29,31,33H,18-22H2,1-2H3/t23-,27+,29-/m1/s1 |
| InChIKey | RGKJAUDEULLISM-FNHKZSGOSA-N |
| XLogP | 4.37 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|