C49H66O6S2Si — CID 11061864
[(1S)-2-hydroxy-1,2,2-triphenylethyl] (3R,5R,7S)-8-(1,3-dithiolan-2-yl)-3-hydroxy-8-methyl-7-phenylmethoxy-5-tri(propan-2-yl)silyloxynonanoate (PubChem CID 11061864) has the molecular formula C49H66O6S2Si and a molecular weight of 843.28 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1,2,2-triphenylethyl] (3R,5R,7S)-8-(1,3-dithiolan-2-yl)-3-hydroxy-8-methyl-7-phenylmethoxy-5-tri(propan-2-yl)silyloxynonanoate.
| Compound Name | [(1S)-2-hydroxy-1,2,2-triphenylethyl] (3R,5R,7S)-8-(1,3-dithiolan-2-yl)-3-hydroxy-8-methyl-7-phenylmethoxy-5-tri(propan-2-yl)silyloxynonanoate |
|---|---|
| PubChem CID | 11061864 |
| Molecular Formula | C49H66O6S2Si |
| Molecular Weight | 843.28 g/mol |
| Exact Mass | 842.41 |
| IUPAC Name | [(1S)-2-hydroxy-1,2,2-triphenylethyl] (3R,5R,7S)-8-(1,3-dithiolan-2-yl)-3-hydroxy-8-methyl-7-phenylmethoxy-5-tri(propan-2-yl)silyloxynonanoate |
| SMILES | CC(C)[Si](O[C@H](C[C@@H](O)CC(=O)O[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1)C[C@H](OCc1ccccc1)C(C)(C)C1SCCS1)(C(C)C)C(C)C |
| InChI | InChI=1S/C49H66O6S2Si/c1-35(2)58(36(3)4,37(5)6)55-43(33-44(48(7,8)47-56-29-30-57-47)53-34-38-21-13-9-14-22-38)31-42(50)32-45(51)54-46(39-23-15-10-16-24-39)49(52,40-25-17-11-18-26-40)41-27-19-12-20-28-41/h9-28,35-37,42-44,46-47,50,52H,29-34H2,1-8H3/t42-,43-,44+,46+/m1/s1 |
| InChIKey | XMEUHVMIVBFZST-JMSRHROSSA-N |
| XLogP | 11.72 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.28 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|