C13H17ClO4 — CID 175615578
(2S,3S,5R)-5-chloro-3-hydroxy-2-methyl-5-phenylmethoxypentanoic acid (PubChem CID 175615578) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is (2S,3S,5R)-5-chloro-3-hydroxy-2-methyl-5-phenylmethoxypentanoic acid.
| Compound Name | (2S,3S,5R)-5-chloro-3-hydroxy-2-methyl-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 175615578 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (2S,3S,5R)-5-chloro-3-hydroxy-2-methyl-5-phenylmethoxypentanoic acid |
| SMILES | C[C@H](C(=O)O)[C@@H](O)C[C@@H](Cl)OCc1ccccc1 |
| InChI | InChI=1S/C13H17ClO4/c1-9(13(16)17)11(15)7-12(14)18-8-10-5-3-2-4-6-10/h2-6,9,11-12,15H,7-8H2,1H3,(H,16,17)/t9-,11-,12-/m0/s1 |
| InChIKey | DZSPZJGAEWCHCL-DLOVCJGASA-N |
| XLogP | 2.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|