C17H24O5 — CID 100924631
(E,3S,6S)-6-(2-methoxyethoxymethoxy)-3-phenylhept-4-enoic acid (PubChem CID 100924631) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (E,3S,6S)-6-(2-methoxyethoxymethoxy)-3-phenylhept-4-enoic acid.
| Compound Name | (E,3S,6S)-6-(2-methoxyethoxymethoxy)-3-phenylhept-4-enoic acid |
|---|---|
| PubChem CID | 100924631 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (E,3S,6S)-6-(2-methoxyethoxymethoxy)-3-phenylhept-4-enoic acid |
| SMILES | COCCOCO[C@@H](C)/C=C/[C@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H24O5/c1-14(22-13-21-11-10-20-2)8-9-16(12-17(18)19)15-6-4-3-5-7-15/h3-9,14,16H,10-13H2,1-2H3,(H,18,19)/b9-8+/t14-,16+/m0/s1 |
| InChIKey | LIAPWXHYEXWQHG-FNHJVCLDSA-N |
| XLogP | 2.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|