C17H24O6 — CID 10615961
[(E,1R,4S)-4-(2-methoxyethoxymethoxy)-1-phenylpent-2-enyl] methyl carbonate (PubChem CID 10615961) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(E,1R,4S)-4-(2-methoxyethoxymethoxy)-1-phenylpent-2-enyl] methyl carbonate.
| Compound Name | [(E,1R,4S)-4-(2-methoxyethoxymethoxy)-1-phenylpent-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 10615961 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(E,1R,4S)-4-(2-methoxyethoxymethoxy)-1-phenylpent-2-enyl] methyl carbonate |
| SMILES | COCCOCO[C@@H](C)/C=C/[C@@H](OC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C17H24O6/c1-14(22-13-21-12-11-19-2)9-10-16(23-17(18)20-3)15-7-5-4-6-8-15/h4-10,14,16H,11-13H2,1-3H3/b10-9+/t14-,16+/m0/s1 |
| InChIKey | SMNOWUPTJWFEMV-KTMLPXRHSA-N |
| XLogP | 3.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|