C24H28O3 — CID 69221223
1,1-diphenylpropane-1,2-diol;2,3,4-trimethylphenol (PubChem CID 69221223) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,1-diphenylpropane-1,2-diol;2,3,4-trimethylphenol.
| Compound Name | 1,1-diphenylpropane-1,2-diol;2,3,4-trimethylphenol |
|---|---|
| PubChem CID | 69221223 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1,1-diphenylpropane-1,2-diol;2,3,4-trimethylphenol |
| SMILES | CC(O)C(O)(c1ccccc1)c1ccccc1.Cc1ccc(O)c(C)c1C |
| InChI | InChI=1S/C15H16O2.C9H12O/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-6-4-5-9(10)8(3)7(6)2/h2-12,16-17H,1H3;4-5,10H,1-3H3 |
| InChIKey | URCHKLWSLXJDMV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |