C12H16O2 — CID 14939211
2-[(2R,3R)-2-hydroxy-3-methylpent-4-en-2-yl]phenol (PubChem CID 14939211) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(2R,3R)-2-hydroxy-3-methylpent-4-en-2-yl]phenol.
| Compound Name | 2-[(2R,3R)-2-hydroxy-3-methylpent-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 14939211 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-[(2R,3R)-2-hydroxy-3-methylpent-4-en-2-yl]phenol |
| SMILES | C=C[C@@H](C)[C@@](C)(O)c1ccccc1O |
| InChI | InChI=1S/C12H16O2/c1-4-9(2)12(3,14)10-7-5-6-8-11(10)13/h4-9,13-14H,1H2,2-3H3/t9-,12-/m1/s1 |
| InChIKey | DBCFGHNZTIRKDH-BXKDBHETSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|